C15H14Cl2FN3O2 — CID 133292437
2-(2,4-dichloro-5-fluorophenyl)-4-(4-methoxypyrimidin-2-yl)morpholine (PubChem CID 133292437) has the molecular formula C15H14Cl2FN3O2 and a molecular weight of 358.20 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-4-(4-methoxypyrimidin-2-yl)morpholine.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-4-(4-methoxypyrimidin-2-yl)morpholine |
|---|---|
| PubChem CID | 133292437 |
| Molecular Formula | C15H14Cl2FN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-4-(4-methoxypyrimidin-2-yl)morpholine |
| SMILES | COc1ccnc(N2CCOC(c3cc(F)c(Cl)cc3Cl)C2)n1 |
| InChI | InChI=1S/C15H14Cl2FN3O2/c1-22-14-2-3-19-15(20-14)21-4-5-23-13(8-21)9-6-12(18)11(17)7-10(9)16/h2-3,6-7,13H,4-5,8H2,1H3 |
| InChIKey | XBUMZKICUALUNL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|