C14H11Cl3FN3O2 — CID 133292436
5-chloro-4-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-1H-pyridazin-6-one (PubChem CID 133292436) has the molecular formula C14H11Cl3FN3O2 and a molecular weight of 378.62 g/mol. Its IUPAC name is 5-chloro-4-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133292436 |
| Molecular Formula | C14H11Cl3FN3O2 |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 5-chloro-4-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N2CCOC(c3cc(F)c(Cl)cc3Cl)C2)c1Cl |
| InChI | InChI=1S/C14H11Cl3FN3O2/c15-8-4-9(16)10(18)3-7(8)12-6-21(1-2-23-12)11-5-19-20-14(22)13(11)17/h3-5,12H,1-2,6H2,(H,20,22) |
| InChIKey | FOCGUDPYXTXMCC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|