C23H26N2O4 — CID 134033514
methyl 2-[[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]amino]-5-morpholin-4-ylbenzoate (PubChem CID 134033514) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]amino]-5-morpholin-4-ylbenzoate.
| Compound Name | methyl 2-[[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]amino]-5-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 134033514 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl 2-[[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]amino]-5-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)/C=C/c1ccc(C)cc1C |
| InChI | InChI=1S/C23H26N2O4/c1-16-4-5-18(17(2)14-16)6-9-22(26)24-21-8-7-19(15-20(21)23(27)28-3)25-10-12-29-13-11-25/h4-9,14-15H,10-13H2,1-3H3,(H,24,26)/b9-6+ |
| InChIKey | PBYAGVHIJBKBPR-RMKNXTFCSA-N |
| XLogP | 3.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|