C21H18N4 — CID 134093610
(2E)-2-(1H-benzimidazol-2-yl)-2-(1-ethyl-6-methylquinolin-2-ylidene)acetonitrile (PubChem CID 134093610) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2E)-2-(1H-benzimidazol-2-yl)-2-(1-ethyl-6-methylquinolin-2-ylidene)acetonitrile.
| Compound Name | (2E)-2-(1H-benzimidazol-2-yl)-2-(1-ethyl-6-methylquinolin-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 134093610 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (2E)-2-(1H-benzimidazol-2-yl)-2-(1-ethyl-6-methylquinolin-2-ylidene)acetonitrile |
| SMILES | CCN1/C(=C(\C#N)c2nc3ccccc3[nH]2)C=Cc2cc(C)ccc21 |
| InChI | InChI=1S/C21H18N4/c1-3-25-19-10-8-14(2)12-15(19)9-11-20(25)16(13-22)21-23-17-6-4-5-7-18(17)24-21/h4-12H,3H2,1-2H3,(H,23,24)/b20-16+ |
| InChIKey | YCDJAYOEPJBURW-CAPFRKAQSA-N |
| XLogP | 4.66 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|