C22H12F8N2O2 — CID 134101759
N-[3-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 134101759) has the molecular formula C22H12F8N2O2 and a molecular weight of 488.33 g/mol. Its IUPAC name is N-[3-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[3-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 134101759 |
| Molecular Formula | C22H12F8N2O2 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | N-[3-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1cc(NC(=O)c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H12F8N2O2/c23-16-14(17(24)19(26)20(27)18(16)25)9-15(33)31-12-6-11(22(28,29)30)7-13(8-12)32-21(34)10-4-2-1-3-5-10/h1-8H,9H2,(H,31,33)(H,32,34) |
| InChIKey | SQLCFAUCEWTANT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|