About (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate
(2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate (PubChem CID 134106265) has the molecular formula C12H13N3O4S
and a molecular weight of 295.32 g/mol. Its IUPAC name is (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate.
Molecular Properties
| Compound Name | (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate |
| PubChem CID | 134106265 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate |
| SMILES | CC1(C)CN(C(=O)Oc2ccccc2[N+](=O)[O-])C(=S)N1 |
| InChI | InChI=1S/C12H13N3O4S/c1-12(2)7-14(10(20)13-12)11(16)19-9-6-4-3-5-8(9)15(17)18/h3-6H,7H2,1-2H3,(H,13,20) |
| InChIKey | KFSZKWKCUAZAFA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate?
The IUPAC name of (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate (CID 134106265) is (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate.
What is the SMILES notation for (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate?
The canonical SMILES for (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate is CC1(C)CN(C(=O)Oc2ccccc2[N+](=O)[O-])C(=S)N1.
What is the InChIKey of (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate?
The InChIKey is KFSZKWKCUAZAFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4S/c1-12(2)7-14(10(20)13-12)11(16)19-9-6-4-3-5-8(9)15(17)18/h3-6H,7H2,1-2H3,(H,13,20).
What are the key properties of (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate?
(2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate has a molecular weight of 295.32 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl) 4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxylate is sourced from PubChem (CID 134106265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).