C12H16N2 — CID 134112300
(E)-N,N-dimethyl-3-(2-methylphenyl)prop-2-enimidamide (PubChem CID 134112300) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-(2-methylphenyl)prop-2-enimidamide.
| Compound Name | (E)-N,N-dimethyl-3-(2-methylphenyl)prop-2-enimidamide |
|---|---|
| PubChem CID | 134112300 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (E)-N,N-dimethyl-3-(2-methylphenyl)prop-2-enimidamide |
| SMILES | [H]/N=C(/C=C/c1ccccc1C)N(C)C |
| InChI | InChI=1S/C12H16N2/c1-10-6-4-5-7-11(10)8-9-12(13)14(2)3/h4-9,13H,1-3H3/b9-8+,13-12- |
| InChIKey | VTWKQCSPPZNFHI-FRGMPSNRSA-N |
| XLogP | 2.55 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|