C13H14F3N3OS2 — CID 134123902
4,4-dimethyl-2-sulfanylidene-N-[3-(trifluoromethylsulfanyl)phenyl]imidazolidine-1-carboxamide (PubChem CID 134123902) has the molecular formula C13H14F3N3OS2 and a molecular weight of 349.40 g/mol. Its IUPAC name is 4,4-dimethyl-2-sulfanylidene-N-[3-(trifluoromethylsulfanyl)phenyl]imidazolidine-1-carboxamide.
| Compound Name | 4,4-dimethyl-2-sulfanylidene-N-[3-(trifluoromethylsulfanyl)phenyl]imidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 134123902 |
| Molecular Formula | C13H14F3N3OS2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4,4-dimethyl-2-sulfanylidene-N-[3-(trifluoromethylsulfanyl)phenyl]imidazolidine-1-carboxamide |
| SMILES | CC1(C)CN(C(=O)Nc2cccc(SC(F)(F)F)c2)C(=S)N1 |
| InChI | InChI=1S/C13H14F3N3OS2/c1-12(2)7-19(11(21)18-12)10(20)17-8-4-3-5-9(6-8)22-13(14,15)16/h3-6H,7H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | IUHBZOWTBWSUCG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|