C13H17N2O2S+ — CID 134125083
6,7-dimethoxy-1,2-dimethyl-4-methylsulfanylquinazolin-1-ium (PubChem CID 134125083) has the molecular formula C13H17N2O2S+ and a molecular weight of 265.36 g/mol. Its IUPAC name is 6,7-dimethoxy-1,2-dimethyl-4-methylsulfanylquinazolin-1-ium.
| Compound Name | 6,7-dimethoxy-1,2-dimethyl-4-methylsulfanylquinazolin-1-ium |
|---|---|
| PubChem CID | 134125083 |
| Molecular Formula | C13H17N2O2S+ |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 6,7-dimethoxy-1,2-dimethyl-4-methylsulfanylquinazolin-1-ium |
| SMILES | COc1cc2c(SC)nc(C)[n+](C)c2cc1OC |
| InChI | InChI=1S/C13H17N2O2S/c1-8-14-13(18-5)9-6-11(16-3)12(17-4)7-10(9)15(8)2/h6-7H,1-5H3/q+1 |
| InChIKey | XECDHLDRHXSVEQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|