C18H19N2O2S+ — CID 66991346
6,7-dimethoxy-1-methyl-4-methylsulfanyl-2-phenylquinazolin-1-ium (PubChem CID 66991346) has the molecular formula C18H19N2O2S+ and a molecular weight of 327.43 g/mol. Its IUPAC name is 6,7-dimethoxy-1-methyl-4-methylsulfanyl-2-phenylquinazolin-1-ium.
| Compound Name | 6,7-dimethoxy-1-methyl-4-methylsulfanyl-2-phenylquinazolin-1-ium |
|---|---|
| PubChem CID | 66991346 |
| Molecular Formula | C18H19N2O2S+ |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 6,7-dimethoxy-1-methyl-4-methylsulfanyl-2-phenylquinazolin-1-ium |
| SMILES | COc1cc2c(SC)nc(-c3ccccc3)[n+](C)c2cc1OC |
| InChI | InChI=1S/C18H19N2O2S/c1-20-14-11-16(22-3)15(21-2)10-13(14)18(23-4)19-17(20)12-8-6-5-7-9-12/h5-11H,1-4H3/q+1 |
| InChIKey | HXBSYVKARQEPAD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|