C13H17IN2O2 — CID 21415702
6,7-dimethoxy-1,2,3-trimethylquinoxalin-1-ium iodide (PubChem CID 21415702) has the molecular formula C13H17IN2O2 and a molecular weight of 360.20 g/mol. Its IUPAC name is 6,7-dimethoxy-1,2,3-trimethylquinoxalin-1-ium iodide.
| Compound Name | 6,7-dimethoxy-1,2,3-trimethylquinoxalin-1-ium iodide |
|---|---|
| PubChem CID | 21415702 |
| Molecular Formula | C13H17IN2O2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 6,7-dimethoxy-1,2,3-trimethylquinoxalin-1-ium iodide |
| SMILES | COc1cc2nc(C)c(C)[n+](C)c2cc1OC.[I-] |
| InChI | InChI=1S/C13H17N2O2.HI/c1-8-9(2)15(3)11-7-13(17-5)12(16-4)6-10(11)14-8;/h6-7H,1-5H3;1H/q+1;/p-1 |
| InChIKey | PHJHTLHVWPSISX-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|