About [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate
[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate (PubChem CID 134125892) has the molecular formula C17H17ClN2O3S
and a molecular weight of 364.85 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate |
| PubChem CID | 134125892 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate |
| SMILES | CC(=O)C1CNC(C(=O)OCc2csc(-c3ccccc3Cl)n2)C1 |
| InChI | InChI=1S/C17H17ClN2O3S/c1-10(21)11-6-15(19-7-11)17(22)23-8-12-9-24-16(20-12)13-4-2-3-5-14(13)18/h2-5,9,11,15,19H,6-8H2,1H3 |
| InChIKey | MTLLACYYKUHMKY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate?
The IUPAC name of [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate (CID 134125892) is [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate.
What is the SMILES notation for [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate?
The canonical SMILES for [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate is CC(=O)C1CNC(C(=O)OCc2csc(-c3ccccc3Cl)n2)C1.
What is the InChIKey of [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate?
The InChIKey is MTLLACYYKUHMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O3S/c1-10(21)11-6-15(19-7-11)17(22)23-8-12-9-24-16(20-12)13-4-2-3-5-14(13)18/h2-5,9,11,15,19H,6-8H2,1H3.
What are the key properties of [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate?
[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate has a molecular weight of 364.85 g/mol, XLogP of 3.07, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-acetylpyrrolidine-2-carboxylate is sourced from PubChem (CID 134125892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).