C13H12Cl2N4O3 — CID 134176208
3-[1-(2,6-dichloro-4-nitrophenyl)cyclopropyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine (PubChem CID 134176208) has the molecular formula C13H12Cl2N4O3 and a molecular weight of 343.17 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-4-nitrophenyl)cyclopropyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-[1-(2,6-dichloro-4-nitrophenyl)cyclopropyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 134176208 |
| Molecular Formula | C13H12Cl2N4O3 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 3-[1-(2,6-dichloro-4-nitrophenyl)cyclopropyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine |
| SMILES | CN(C)c1nc(C2(c3c(Cl)cc([N+](=O)[O-])cc3Cl)CC2)no1 |
| InChI | InChI=1S/C13H12Cl2N4O3/c1-18(2)12-16-11(17-22-12)13(3-4-13)10-8(14)5-7(19(20)21)6-9(10)15/h5-6H,3-4H2,1-2H3 |
| InChIKey | JZAFDBAEJWZRQM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|