C13H8Cl2F10N2OS2 — CID 134177482
1,3-bis[4-chloro-3-(pentafluoro-λ6-sulfanyl)phenyl]urea (PubChem CID 134177482) has the molecular formula C13H8Cl2F10N2OS2 and a molecular weight of 533.24 g/mol. Its IUPAC name is 1,3-bis[4-chloro-3-(pentafluoro-λ6-sulfanyl)phenyl]urea.
| Compound Name | 1,3-bis[4-chloro-3-(pentafluoro-λ6-sulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 134177482 |
| Molecular Formula | C13H8Cl2F10N2OS2 |
| Molecular Weight | 533.24 g/mol |
| Exact Mass | 531.93 |
| IUPAC Name | 1,3-bis[4-chloro-3-(pentafluoro-λ6-sulfanyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(F)(F)(F)(F)F)c1)Nc1ccc(Cl)c(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C13H8Cl2F10N2OS2/c14-9-3-1-7(5-11(9)29(16,17,18,19)20)26-13(28)27-8-2-4-10(15)12(6-8)30(21,22,23,24)25/h1-6H,(H2,26,27,28) |
| InChIKey | ZQZVNIUSAYCIKR-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.24 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |