C26H31F3N3O4P — CID 134188736
2-[5-[4-[difluoro(phosphanyl)methyl]-2-fluorophenyl]-2-ethyl-5-oxopentyl]-4-methoxy-N-(2-methoxyethyl)indazole-5-carboxamide (PubChem CID 134188736) has the molecular formula C26H31F3N3O4P and a molecular weight of 537.52 g/mol. Its IUPAC name is 2-[5-[4-[difluoro(phosphanyl)methyl]-2-fluorophenyl]-2-ethyl-5-oxopentyl]-4-methoxy-N-(2-methoxyethyl)indazole-5-carboxamide.
| Compound Name | 2-[5-[4-[difluoro(phosphanyl)methyl]-2-fluorophenyl]-2-ethyl-5-oxopentyl]-4-methoxy-N-(2-methoxyethyl)indazole-5-carboxamide |
|---|---|
| PubChem CID | 134188736 |
| Molecular Formula | C26H31F3N3O4P |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2-[5-[4-[difluoro(phosphanyl)methyl]-2-fluorophenyl]-2-ethyl-5-oxopentyl]-4-methoxy-N-(2-methoxyethyl)indazole-5-carboxamide |
| SMILES | CCC(CCC(=O)c1ccc(C(F)(F)P)cc1F)Cn1cc2c(OC)c(C(=O)NCCOC)ccc2n1 |
| InChI | InChI=1S/C26H31F3N3O4P/c1-4-16(5-10-23(33)18-7-6-17(13-21(18)27)26(28,29)37)14-32-15-20-22(31-32)9-8-19(24(20)36-3)25(34)30-11-12-35-2/h6-9,13,15-16H,4-5,10-12,14,37H2,1-3H3,(H,30,34) |
| InChIKey | YYUSYZJYDQXWCU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|