C24H39N3O7 — CID 144747681
ethane;2-hydroxypropan-2-yl 4-[[4-(hydroxymethoxy)-5-(2-methoxyethylcarbamoyl)indazol-2-yl]methyl]hexanoate (PubChem CID 144747681) has the molecular formula C24H39N3O7 and a molecular weight of 481.59 g/mol. Its IUPAC name is ethane;2-hydroxypropan-2-yl 4-[[4-(hydroxymethoxy)-5-(2-methoxyethylcarbamoyl)indazol-2-yl]methyl]hexanoate.
| Compound Name | ethane;2-hydroxypropan-2-yl 4-[[4-(hydroxymethoxy)-5-(2-methoxyethylcarbamoyl)indazol-2-yl]methyl]hexanoate |
|---|---|
| PubChem CID | 144747681 |
| Molecular Formula | C24H39N3O7 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | ethane;2-hydroxypropan-2-yl 4-[[4-(hydroxymethoxy)-5-(2-methoxyethylcarbamoyl)indazol-2-yl]methyl]hexanoate |
| SMILES | CC.CCC(CCC(=O)OC(C)(C)O)Cn1cc2c(OCO)c(C(=O)NCCOC)ccc2n1 |
| InChI | InChI=1S/C22H33N3O7.C2H6/c1-5-15(6-9-19(27)32-22(2,3)29)12-25-13-17-18(24-25)8-7-16(20(17)31-14-26)21(28)23-10-11-30-4;1-2/h7-8,13,15,26,29H,5-6,9-12,14H2,1-4H3,(H,23,28);1-2H3 |
| InChIKey | GAUOWDDGCRGZKH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|