C24H15Cl2F2NO3 — CID 134204910
4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]-2-ethyl-3-fluorobenzoic acid (PubChem CID 134204910) has the molecular formula C24H15Cl2F2NO3 and a molecular weight of 474.29 g/mol. Its IUPAC name is 4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]-2-ethyl-3-fluorobenzoic acid.
| Compound Name | 4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]-2-ethyl-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 134204910 |
| Molecular Formula | C24H15Cl2F2NO3 |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]-2-ethyl-3-fluorobenzoic acid |
| SMILES | CCc1c(C(=O)O)ccc(-n2cc(C(=O)c3c(Cl)cccc3Cl)c3c(F)cccc32)c1F |
| InChI | InChI=1S/C24H15Cl2F2NO3/c1-2-12-13(24(31)32)9-10-19(22(12)28)29-11-14(20-17(27)7-4-8-18(20)29)23(30)21-15(25)5-3-6-16(21)26/h3-11H,2H2,1H3,(H,31,32) |
| InChIKey | PWFXFFZLEYDIHD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |