C12H18O13 — CID 134248802
(2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 134248802) has the molecular formula C12H18O13 and a molecular weight of 370.26 g/mol. Its IUPAC name is (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 134248802 |
| Molecular Formula | C12H18O13 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | O=C1O[C@H](C(O)CO)C(O)=C1O.O=CC(O)C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C6H10O7.C6H8O6/c7-1-2(8)3(9)4(10)5(11)6(12)13;7-1-2(8)5-3(9)4(10)6(11)12-5/h1-5,8-11H,(H,12,13);2,5,7-10H,1H2/t;2?,5-/m.1/s1 |
| InChIKey | YDKJQSLVVRLUAD-NQSOLIBNSA-N |
| XLogP | -4.69 |
| TPSA | 242.51 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|