C25H39F4O6P — CID 134253441
phosphonooxymethyl 4-(3,3,7,7-tetrafluoro-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 134253441) has the molecular formula C25H39F4O6P and a molecular weight of 542.55 g/mol. Its IUPAC name is phosphonooxymethyl 4-(3,3,7,7-tetrafluoro-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | phosphonooxymethyl 4-(3,3,7,7-tetrafluoro-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 134253441 |
| Molecular Formula | C25H39F4O6P |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | phosphonooxymethyl 4-(3,3,7,7-tetrafluoro-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CC(CCC(=O)OCOP(=O)(O)O)C1CCC2C3C(CCC12C)C1(C)CCC(F)(F)CC1CC3(F)F |
| InChI | InChI=1S/C25H39F4O6P/c1-15(4-7-20(30)34-14-35-36(31,32)33)17-5-6-18-21-19(8-9-23(17,18)3)22(2)10-11-24(26,27)12-16(22)13-25(21,28)29/h15-19,21H,4-14H2,1-3H3,(H2,31,32,33) |
| InChIKey | WAKUBIXKHJWPPE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|