C23H16F5N3O2 — CID 134275489
[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-phenoxazin-10-ylmethanone (PubChem CID 134275489) has the molecular formula C23H16F5N3O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is [4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-phenoxazin-10-ylmethanone.
| Compound Name | [4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-phenoxazin-10-ylmethanone |
|---|---|
| PubChem CID | 134275489 |
| Molecular Formula | C23H16F5N3O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-phenoxazin-10-ylmethanone |
| SMILES | O=C(N1CCN(c2c(F)c(F)c(F)c(F)c2F)CC1)N1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C23H16F5N3O2/c24-17-18(25)20(27)22(21(28)19(17)26)29-9-11-30(12-10-29)23(32)31-13-5-1-3-7-15(13)33-16-8-4-2-6-14(16)31/h1-8H,9-12H2 |
| InChIKey | SPNUWRHSRATEQQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|