C24H39F3N4 — CID 134298706
N-octyl-N-[[6-(trifluoromethyl)benzotriazol-1-yl]methyl]octan-1-amine (PubChem CID 134298706) has the molecular formula C24H39F3N4 and a molecular weight of 440.60 g/mol. Its IUPAC name is N-octyl-N-[[6-(trifluoromethyl)benzotriazol-1-yl]methyl]octan-1-amine.
| Compound Name | N-octyl-N-[[6-(trifluoromethyl)benzotriazol-1-yl]methyl]octan-1-amine |
|---|---|
| PubChem CID | 134298706 |
| Molecular Formula | C24H39F3N4 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | N-octyl-N-[[6-(trifluoromethyl)benzotriazol-1-yl]methyl]octan-1-amine |
| SMILES | CCCCCCCCN(CCCCCCCC)Cn1nnc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C24H39F3N4/c1-3-5-7-9-11-13-17-30(18-14-12-10-8-6-4-2)20-31-23-19-21(24(25,26)27)15-16-22(23)28-29-31/h15-16,19H,3-14,17-18,20H2,1-2H3 |
| InChIKey | QWVPKRKSWRGING-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|