C18H31NO — CID 134347259
2-amino-3,4,5,6-tetra(propan-2-yl)phenol (PubChem CID 134347259) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 2-amino-3,4,5,6-tetra(propan-2-yl)phenol.
| Compound Name | 2-amino-3,4,5,6-tetra(propan-2-yl)phenol |
|---|---|
| PubChem CID | 134347259 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 2-amino-3,4,5,6-tetra(propan-2-yl)phenol |
| SMILES | CC(C)c1c(N)c(O)c(C(C)C)c(C(C)C)c1C(C)C |
| InChI | InChI=1S/C18H31NO/c1-9(2)13-14(10(3)4)16(12(7)8)18(20)17(19)15(13)11(5)6/h9-12,20H,19H2,1-8H3 |
| InChIKey | WNZPIPXFNYGFJZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|