C21H26IN7O — CID 134383486
N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-4-imidazol-1-yl-5-iodopyrimidin-2-amine (PubChem CID 134383486) has the molecular formula C21H26IN7O and a molecular weight of 519.39 g/mol. Its IUPAC name is N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-4-imidazol-1-yl-5-iodopyrimidin-2-amine.
| Compound Name | N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-4-imidazol-1-yl-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 134383486 |
| Molecular Formula | C21H26IN7O |
| Molecular Weight | 519.39 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-4-imidazol-1-yl-5-iodopyrimidin-2-amine |
| SMILES | COc1cc(Nc2ncc(I)c(-n3ccnc3)n2)ccc1N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C21H26IN7O/c1-27(2)16-6-9-28(10-7-16)18-5-4-15(12-19(18)30-3)25-21-24-13-17(22)20(26-21)29-11-8-23-14-29/h4-5,8,11-14,16H,6-7,9-10H2,1-3H3,(H,24,25,26) |
| InChIKey | FKOACFLWIRHQLY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|