C21H43N3 — CID 134388513
(3Z)-7-N-butyl-6-ethyl-2-N,2-N,10-trimethyldodeca-1,3-diene-2,7,8-triamine (PubChem CID 134388513) has the molecular formula C21H43N3 and a molecular weight of 337.60 g/mol. Its IUPAC name is (3Z)-7-N-butyl-6-ethyl-2-N,2-N,10-trimethyldodeca-1,3-diene-2,7,8-triamine.
| Compound Name | (3Z)-7-N-butyl-6-ethyl-2-N,2-N,10-trimethyldodeca-1,3-diene-2,7,8-triamine |
|---|---|
| PubChem CID | 134388513 |
| Molecular Formula | C21H43N3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.35 |
| IUPAC Name | (3Z)-7-N-butyl-6-ethyl-2-N,2-N,10-trimethyldodeca-1,3-diene-2,7,8-triamine |
| SMILES | C=C(/C=C\CC(CC)C(NCCCC)C(N)CC(C)CC)N(C)C |
| InChI | InChI=1S/C21H43N3/c1-8-11-15-23-21(20(22)16-17(4)9-2)19(10-3)14-12-13-18(5)24(6)7/h12-13,17,19-21,23H,5,8-11,14-16,22H2,1-4,6-7H3/b13-12- |
| InChIKey | RGSWEFSONFNOIS-SEYXRHQNSA-N |
| XLogP | 4.56 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|