C23H42N2O6 — CID 134403484
1-[2-[2-[2-[2-[3-(5,5-dimethylhexylamino)propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (PubChem CID 134403484) has the molecular formula C23H42N2O6 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[3-(5,5-dimethylhexylamino)propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-[2-[2-[3-(5,5-dimethylhexylamino)propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134403484 |
| Molecular Formula | C23H42N2O6 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 1-[2-[2-[2-[2-[3-(5,5-dimethylhexylamino)propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| SMILES | CC(C)(C)CCCCNCCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H42N2O6/c1-23(2,3)9-4-5-10-24-11-6-13-28-15-17-30-19-20-31-18-16-29-14-12-25-21(26)7-8-22(25)27/h7-8,24H,4-6,9-20H2,1-3H3 |
| InChIKey | UHABQVLRWTVOCU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|