C21H20N4O2 — CID 134412517
(3S,4S)-1-methyl-4-(4-methylphenyl)-N-(1,8-naphthyridin-2-yl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134412517) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (3S,4S)-1-methyl-4-(4-methylphenyl)-N-(1,8-naphthyridin-2-yl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-methyl-4-(4-methylphenyl)-N-(1,8-naphthyridin-2-yl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412517 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (3S,4S)-1-methyl-4-(4-methylphenyl)-N-(1,8-naphthyridin-2-yl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc([C@H]2CN(C)C(=O)[C@@H]2C(=O)Nc2ccc3cccnc3n2)cc1 |
| InChI | InChI=1S/C21H20N4O2/c1-13-5-7-14(8-6-13)16-12-25(2)21(27)18(16)20(26)24-17-10-9-15-4-3-11-22-19(15)23-17/h3-11,16,18H,12H2,1-2H3,(H,22,23,24,26)/t16-,18+/m1/s1 |
| InChIKey | IJVKAUZLFIJVAR-AEFFLSMTSA-N |
| XLogP | 2.75 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|