C21H18Cl2F3N — CID 134441428
3-but-1-en-2-yl-N-[1-[2,2-dichloro-3-(4-fluorophenyl)cyclopropyl]ethenyl]-2,4-difluoroaniline (PubChem CID 134441428) has the molecular formula C21H18Cl2F3N and a molecular weight of 412.28 g/mol. Its IUPAC name is 3-but-1-en-2-yl-N-[1-[2,2-dichloro-3-(4-fluorophenyl)cyclopropyl]ethenyl]-2,4-difluoroaniline.
| Compound Name | 3-but-1-en-2-yl-N-[1-[2,2-dichloro-3-(4-fluorophenyl)cyclopropyl]ethenyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 134441428 |
| Molecular Formula | C21H18Cl2F3N |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 3-but-1-en-2-yl-N-[1-[2,2-dichloro-3-(4-fluorophenyl)cyclopropyl]ethenyl]-2,4-difluoroaniline |
| SMILES | C=C(CC)c1c(F)ccc(NC(=C)C2C(c3ccc(F)cc3)C2(Cl)Cl)c1F |
| InChI | InChI=1S/C21H18Cl2F3N/c1-4-11(2)17-15(25)9-10-16(20(17)26)27-12(3)18-19(21(18,22)23)13-5-7-14(24)8-6-13/h5-10,18-19,27H,2-4H2,1H3 |
| InChIKey | FMCRKNNPBFAWOL-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|