C32H49N3O4 — CID 134472974
[(2R,6R,9R,10R,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-17,19-dioxo-16,18,20-triazahexacyclo[13.5.2.01,9.02,6.010,15.016,20]docos-21-en-13-yl] propanoate (PubChem CID 134472974) has the molecular formula C32H49N3O4 and a molecular weight of 539.76 g/mol. Its IUPAC name is [(2R,6R,9R,10R,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-17,19-dioxo-16,18,20-triazahexacyclo[13.5.2.01,9.02,6.010,15.016,20]docos-21-en-13-yl] propanoate.
| Compound Name | [(2R,6R,9R,10R,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-17,19-dioxo-16,18,20-triazahexacyclo[13.5.2.01,9.02,6.010,15.016,20]docos-21-en-13-yl] propanoate |
|---|---|
| PubChem CID | 134472974 |
| Molecular Formula | C32H49N3O4 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | [(2R,6R,9R,10R,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-17,19-dioxo-16,18,20-triazahexacyclo[13.5.2.01,9.02,6.010,15.016,20]docos-21-en-13-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)C([C@H](C)CCCC(C)C)CC[C@H]4C34C=CC2(C1)n1c(=O)[nH]c(=O)n14 |
| InChI | InChI=1S/C32H49N3O4/c1-7-26(36)39-22-13-16-30(6)25-14-15-29(5)23(21(4)10-8-9-20(2)3)11-12-24(29)32(25)18-17-31(30,19-22)34-27(37)33-28(38)35(32)34/h17-18,20-25H,7-16,19H2,1-6H3,(H,33,37,38)/t21-,22+,23?,24-,25-,29-,30-,31?,32?/m1/s1 |
| InChIKey | CDWSJTPPINSDPL-NTOCLOSKSA-N |
| XLogP | 5.73 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|