C10H18N2O8 — CID 134489592
(2S,3S,4R,5S)-6-[[(3R)-3-amino-4-oxobutanoyl]amino]-2,3,4,5-tetrahydroxyhexanoic acid (PubChem CID 134489592) has the molecular formula C10H18N2O8 and a molecular weight of 294.26 g/mol. Its IUPAC name is (2S,3S,4R,5S)-6-[[(3R)-3-amino-4-oxobutanoyl]amino]-2,3,4,5-tetrahydroxyhexanoic acid.
| Compound Name | (2S,3S,4R,5S)-6-[[(3R)-3-amino-4-oxobutanoyl]amino]-2,3,4,5-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 134489592 |
| Molecular Formula | C10H18N2O8 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2S,3S,4R,5S)-6-[[(3R)-3-amino-4-oxobutanoyl]amino]-2,3,4,5-tetrahydroxyhexanoic acid |
| SMILES | N[C@@H](C=O)CC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C10H18N2O8/c11-4(3-13)1-6(15)12-2-5(14)7(16)8(17)9(18)10(19)20/h3-5,7-9,14,16-18H,1-2,11H2,(H,12,15)(H,19,20)/t4-,5+,7-,8+,9+/m1/s1 |
| InChIKey | WLJMYGALCNEPCK-YWDPQQRZSA-N |
| XLogP | -4.45 |
| TPSA | 190.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|