C19H18INO6 — CID 134573046
methyl 3-formyl-8-iodo-1-methoxy-7-oxo-6-phenylmethoxy-2,3-dihydro-1H-indolizine-5-carboxylate (PubChem CID 134573046) has the molecular formula C19H18INO6 and a molecular weight of 483.26 g/mol. Its IUPAC name is methyl 3-formyl-8-iodo-1-methoxy-7-oxo-6-phenylmethoxy-2,3-dihydro-1H-indolizine-5-carboxylate.
| Compound Name | methyl 3-formyl-8-iodo-1-methoxy-7-oxo-6-phenylmethoxy-2,3-dihydro-1H-indolizine-5-carboxylate |
|---|---|
| PubChem CID | 134573046 |
| Molecular Formula | C19H18INO6 |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | methyl 3-formyl-8-iodo-1-methoxy-7-oxo-6-phenylmethoxy-2,3-dihydro-1H-indolizine-5-carboxylate |
| SMILES | COC(=O)c1c(OCc2ccccc2)c(=O)c(I)c2n1C(C=O)CC2OC |
| InChI | InChI=1S/C19H18INO6/c1-25-13-8-12(9-22)21-15(13)14(20)17(23)18(16(21)19(24)26-2)27-10-11-6-4-3-5-7-11/h3-7,9,12-13H,8,10H2,1-2H3 |
| InChIKey | SMFGJOIETJLHBI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|