C21H24FN3 — CID 134591446
1-[3-cyclopropyl-5-(2-fluoro-3-propylphenyl)-2-pyridinyl]-N-methylazetidin-3-imine (PubChem CID 134591446) has the molecular formula C21H24FN3 and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-[3-cyclopropyl-5-(2-fluoro-3-propylphenyl)-2-pyridinyl]-N-methylazetidin-3-imine.
| Compound Name | 1-[3-cyclopropyl-5-(2-fluoro-3-propylphenyl)-2-pyridinyl]-N-methylazetidin-3-imine |
|---|---|
| PubChem CID | 134591446 |
| Molecular Formula | C21H24FN3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-[3-cyclopropyl-5-(2-fluoro-3-propylphenyl)-2-pyridinyl]-N-methylazetidin-3-imine |
| SMILES | CCCc1cccc(-c2cnc(N3CC(=NC)C3)c(C3CC3)c2)c1F |
| InChI | InChI=1S/C21H24FN3/c1-3-5-15-6-4-7-18(20(15)22)16-10-19(14-8-9-14)21(24-11-16)25-12-17(13-25)23-2/h4,6-7,10-11,14H,3,5,8-9,12-13H2,1-2H3 |
| InChIKey | XZHNYQFWDPAGGJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|