C18H11Br3N2O8 — CID 134834481
(2E)-3-[3,5-dibromo-4-[[(3Z)-7-bromo-3-hydroxyimino-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-9-yl]oxy]phenyl]-2-hydroxyiminopropanoic acid (PubChem CID 134834481) has the molecular formula C18H11Br3N2O8 and a molecular weight of 623.00 g/mol. Its IUPAC name is (2E)-3-[3,5-dibromo-4-[[(3Z)-7-bromo-3-hydroxyimino-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-9-yl]oxy]phenyl]-2-hydroxyiminopropanoic acid.
| Compound Name | (2E)-3-[3,5-dibromo-4-[[(3Z)-7-bromo-3-hydroxyimino-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-9-yl]oxy]phenyl]-2-hydroxyiminopropanoic acid |
|---|---|
| PubChem CID | 134834481 |
| Molecular Formula | C18H11Br3N2O8 |
| Molecular Weight | 623.00 g/mol |
| Exact Mass | 619.81 |
| IUPAC Name | (2E)-3-[3,5-dibromo-4-[[(3Z)-7-bromo-3-hydroxyimino-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-9-yl]oxy]phenyl]-2-hydroxyiminopropanoic acid |
| SMILES | O=C1C(Br)=CC2(C=C1Oc1c(Br)cc(C/C(=N\O)C(=O)O)cc1Br)C/C(=N/O)C(=O)O2 |
| InChI | InChI=1S/C18H11Br3N2O8/c19-8-1-7(3-11(22-28)16(25)26)2-9(20)15(8)30-13-6-18(4-10(21)14(13)24)5-12(23-29)17(27)31-18/h1-2,4,6,28-29H,3,5H2,(H,25,26)/b22-11+,23-12- |
| InChIKey | BQOMKBNGYSAATF-BJLCGXAESA-N |
| XLogP | 3.31 |
| TPSA | 155.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.00 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|