C33H48O4Si — CID 134835889
1-[(4S,6S)-6-[(3S)-3-[tert-butyl(diphenyl)silyl]oxyhexyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-one (PubChem CID 134835889) has the molecular formula C33H48O4Si and a molecular weight of 536.83 g/mol. Its IUPAC name is 1-[(4S,6S)-6-[(3S)-3-[tert-butyl(diphenyl)silyl]oxyhexyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-one.
| Compound Name | 1-[(4S,6S)-6-[(3S)-3-[tert-butyl(diphenyl)silyl]oxyhexyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-one |
|---|---|
| PubChem CID | 134835889 |
| Molecular Formula | C33H48O4Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 1-[(4S,6S)-6-[(3S)-3-[tert-butyl(diphenyl)silyl]oxyhexyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-one |
| SMILES | C=CCC(=O)C[C@@H]1C[C@H](CC[C@H](CCC)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C33H48O4Si/c1-8-16-26(34)24-29-25-28(35-33(6,7)36-29)23-22-27(17-9-2)37-38(32(3,4)5,30-18-12-10-13-19-30)31-20-14-11-15-21-31/h8,10-15,18-21,27-29H,1,9,16-17,22-25H2,2-7H3/t27-,28-,29+/m0/s1 |
| InChIKey | XXMIVWUAHMKYOR-YTCPBCGMSA-N |
| XLogP | 6.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|