C34H44O4Si — CID 134839373
2-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]acetaldehyde (PubChem CID 134839373) has the molecular formula C34H44O4Si and a molecular weight of 544.81 g/mol. Its IUPAC name is 2-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 134839373 |
| Molecular Formula | C34H44O4Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | 2-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](O[C@@H](CCOCc1ccccc1)C[C@@H]1CCC[C@H](CC=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H44O4Si/c1-34(2,3)39(32-18-9-5-10-19-32,33-20-11-6-12-21-33)38-31(23-25-36-27-28-14-7-4-8-15-28)26-30-17-13-16-29(37-30)22-24-35/h4-12,14-15,18-21,24,29-31H,13,16-17,22-23,25-27H2,1-3H3/t29-,30+,31+/m1/s1 |
| InChIKey | NMCPWAWLXPGWQI-AYQJTBPPSA-N |
| XLogP | 6.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|