C23H28O5S — CID 134844704
(4R,5R)-4-[(2S)-1-(benzenesulfonyl)but-3-en-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane (PubChem CID 134844704) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is (4R,5R)-4-[(2S)-1-(benzenesulfonyl)but-3-en-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[(2S)-1-(benzenesulfonyl)but-3-en-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 134844704 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (4R,5R)-4-[(2S)-1-(benzenesulfonyl)but-3-en-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
| SMILES | C=C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C23H28O5S/c1-4-19(17-29(24,25)20-13-9-6-10-14-20)22-21(27-23(2,3)28-22)16-26-15-18-11-7-5-8-12-18/h4-14,19,21-22H,1,15-17H2,2-3H3/t19-,21-,22-/m1/s1 |
| InChIKey | IZFFEVBOXKJLHK-CEMLEFRQSA-N |
| XLogP | 4.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|