C15H16N4 — CID 134862852
N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine (PubChem CID 134862852) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine.
| Compound Name | N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine |
|---|---|
| PubChem CID | 134862852 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine |
| SMILES | Cc1nc2nc(-c3ccccc3)ccn2c1N(C)C |
| InChI | InChI=1S/C15H16N4/c1-11-14(18(2)3)19-10-9-13(17-15(19)16-11)12-7-5-4-6-8-12/h4-10H,1-3H3 |
| InChIKey | HWKMSUJKZUOFTL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |