About N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine
N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine (PubChem CID 134862852) has the molecular formula C15H16N4
and a molecular weight of 252.32 g/mol. Its IUPAC name is N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine |
| PubChem CID | 134862852 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine |
| SMILES | Cc1nc2nc(-c3ccccc3)ccn2c1N(C)C |
| InChI | InChI=1S/C15H16N4/c1-11-14(18(2)3)19-10-9-13(17-15(19)16-11)12-7-5-4-6-8-12/h4-10H,1-3H3 |
| InChIKey | HWKMSUJKZUOFTL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine?
The IUPAC name of N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine (CID 134862852) is N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine.
What is the SMILES notation for N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine?
The canonical SMILES for N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine is Cc1nc2nc(-c3ccccc3)ccn2c1N(C)C.
What is the InChIKey of N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine?
The InChIKey is HWKMSUJKZUOFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4/c1-11-14(18(2)3)19-10-9-13(17-15(19)16-11)12-7-5-4-6-8-12/h4-10H,1-3H3.
What are the key properties of N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine?
N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine has a molecular weight of 252.32 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trimethyl-7-phenylimidazo[1,2-a]pyrimidin-3-amine is sourced from PubChem (CID 134862852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).