C19H23NO6 — CID 134864068
dimethyl (4S,7R,8S)-6,6-dimethyl-1-oxo-4-phenyl-4,7,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate (PubChem CID 134864068) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is dimethyl (4S,7R,8S)-6,6-dimethyl-1-oxo-4-phenyl-4,7,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate.
| Compound Name | dimethyl (4S,7R,8S)-6,6-dimethyl-1-oxo-4-phenyl-4,7,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 134864068 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | dimethyl (4S,7R,8S)-6,6-dimethyl-1-oxo-4-phenyl-4,7,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C2C(=O)OC[C@H](c3ccccc3)N2C(C)(C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H23NO6/c1-19(2)14(17(22)25-4)13(16(21)24-3)15-18(23)26-10-12(20(15)19)11-8-6-5-7-9-11/h5-9,12-15H,10H2,1-4H3/t12-,13+,14+,15?/m1/s1 |
| InChIKey | SYSZYZPDUMFKIF-CXJJLCSMSA-N |
| XLogP | 1.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|