C15H15NO4 — CID 134865522
(1S,2S,6R,9S)-9-phenyl-4,11-dioxa-8-azatricyclo[6.4.0.02,6]dodecane-5,12-dione (PubChem CID 134865522) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-phenyl-4,11-dioxa-8-azatricyclo[6.4.0.02,6]dodecane-5,12-dione.
| Compound Name | (1S,2S,6R,9S)-9-phenyl-4,11-dioxa-8-azatricyclo[6.4.0.02,6]dodecane-5,12-dione |
|---|---|
| PubChem CID | 134865522 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (1S,2S,6R,9S)-9-phenyl-4,11-dioxa-8-azatricyclo[6.4.0.02,6]dodecane-5,12-dione |
| SMILES | O=C1OC[C@H]2[C@@H]1CN1[C@@H](c3ccccc3)COC(=O)[C@H]21 |
| InChI | InChI=1S/C15H15NO4/c17-14-10-6-16-12(9-4-2-1-3-5-9)8-20-15(18)13(16)11(10)7-19-14/h1-5,10-13H,6-8H2/t10-,11-,12+,13-/m0/s1 |
| InChIKey | MXDVECQGXDFTCY-RVMXOQNASA-N |
| XLogP | 0.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |