C18H16Br2O2 — CID 134866217
(2Z)-10,11-dibromo-5,16-dimethoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene (PubChem CID 134866217) has the molecular formula C18H16Br2O2 and a molecular weight of 424.13 g/mol. Its IUPAC name is (2Z)-10,11-dibromo-5,16-dimethoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene.
| Compound Name | (2Z)-10,11-dibromo-5,16-dimethoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene |
|---|---|
| PubChem CID | 134866217 |
| Molecular Formula | C18H16Br2O2 |
| Molecular Weight | 424.13 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | (2Z)-10,11-dibromo-5,16-dimethoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,13,15-heptaene |
| SMILES | COc1cccc2c1/C=C\c1c(OC)cccc1C(Br)C2Br |
| InChI | InChI=1S/C18H16Br2O2/c1-21-15-7-3-5-13-11(15)9-10-12-14(18(20)17(13)19)6-4-8-16(12)22-2/h3-10,17-18H,1-2H3/b10-9- |
| InChIKey | IKNRUDVLBQDQCV-KTKRTIGZSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.13 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|