C9H12Br2O2Te — CID 139154969
2-[dibromo(methyl)-λ4-tellanyl]-1,3-dimethoxybenzene (PubChem CID 139154969) has the molecular formula C9H12Br2O2Te and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-[dibromo(methyl)-λ4-tellanyl]-1,3-dimethoxybenzene.
| Compound Name | 2-[dibromo(methyl)-λ4-tellanyl]-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 139154969 |
| Molecular Formula | C9H12Br2O2Te |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.83 |
| IUPAC Name | 2-[dibromo(methyl)-λ4-tellanyl]-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1[Te](C)(Br)Br |
| InChI | InChI=1S/C9H12Br2O2Te/c1-12-7-5-4-6-8(13-2)9(7)14(3,10)11/h4-6H,1-3H3 |
| InChIKey | YIRKUSDPHLSUQS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|