C11H16Br2O2Te — CID 177487878
2-[dibromo(propan-2-yl)-λ4-tellanyl]-1,3-dimethoxybenzene (PubChem CID 177487878) has the molecular formula C11H16Br2O2Te and a molecular weight of 467.66 g/mol. Its IUPAC name is 2-[dibromo(propan-2-yl)-λ4-tellanyl]-1,3-dimethoxybenzene.
| Compound Name | 2-[dibromo(propan-2-yl)-λ4-tellanyl]-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 177487878 |
| Molecular Formula | C11H16Br2O2Te |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.86 |
| IUPAC Name | 2-[dibromo(propan-2-yl)-λ4-tellanyl]-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1[Te](Br)(Br)C(C)C |
| InChI | InChI=1S/C11H16Br2O2Te/c1-8(2)16(12,13)11-9(14-3)6-5-7-10(11)15-4/h5-8H,1-4H3 |
| InChIKey | GOFCRQGQSOPBSJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|