C8H9Br3O2Te — CID 177411564
1,3-dimethoxy-2-(tribromo-λ4-tellanyl)benzene (PubChem CID 177411564) has the molecular formula C8H9Br3O2Te and a molecular weight of 504.47 g/mol. Its IUPAC name is 1,3-dimethoxy-2-(tribromo-λ4-tellanyl)benzene.
| Compound Name | 1,3-dimethoxy-2-(tribromo-λ4-tellanyl)benzene |
|---|---|
| PubChem CID | 177411564 |
| Molecular Formula | C8H9Br3O2Te |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 503.72 |
| IUPAC Name | 1,3-dimethoxy-2-(tribromo-λ4-tellanyl)benzene |
| SMILES | COc1cccc(OC)c1[Te](Br)(Br)Br |
| InChI | InChI=1S/C8H9Br3O2Te/c1-12-6-4-3-5-7(13-2)8(6)14(9,10)11/h3-5H,1-2H3 |
| InChIKey | YATLGIDAENRESW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|