C16H18ClNO4 — CID 134872293
[1-(4-chlorophenyl)-3-(cyclopentylamino)-1,3-dioxopropan-2-yl] acetate (PubChem CID 134872293) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-(cyclopentylamino)-1,3-dioxopropan-2-yl] acetate.
| Compound Name | [1-(4-chlorophenyl)-3-(cyclopentylamino)-1,3-dioxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 134872293 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [1-(4-chlorophenyl)-3-(cyclopentylamino)-1,3-dioxopropan-2-yl] acetate |
| SMILES | CC(=O)OC(C(=O)NC1CCCC1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClNO4/c1-10(19)22-15(16(21)18-13-4-2-3-5-13)14(20)11-6-8-12(17)9-7-11/h6-9,13,15H,2-5H2,1H3,(H,18,21) |
| InChIKey | BWQQTWUKAUDHHT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|