C32H35LiO3 — CID 134873666
lithium (Z)-(2,6-ditert-butyl-4-methoxyphenoxy)-[(1R)-1-phenyl-1H-naphthalen-2-ylidene]methanolate (PubChem CID 134873666) has the molecular formula C32H35LiO3 and a molecular weight of 474.57 g/mol. Its IUPAC name is lithium (Z)-(2,6-ditert-butyl-4-methoxyphenoxy)-[(1R)-1-phenyl-1H-naphthalen-2-ylidene]methanolate.
| Compound Name | lithium (Z)-(2,6-ditert-butyl-4-methoxyphenoxy)-[(1R)-1-phenyl-1H-naphthalen-2-ylidene]methanolate |
|---|---|
| PubChem CID | 134873666 |
| Molecular Formula | C32H35LiO3 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | lithium (Z)-(2,6-ditert-butyl-4-methoxyphenoxy)-[(1R)-1-phenyl-1H-naphthalen-2-ylidene]methanolate |
| SMILES | COc1cc(C(C)(C)C)c(O/C([O-])=C2/C=Cc3ccccc3[C@H]2c2ccccc2)c(C(C)(C)C)c1.[Li+] |
| InChI | InChI=1S/C32H36O3.Li/c1-31(2,3)26-19-23(34-7)20-27(32(4,5)6)29(26)35-30(33)25-18-17-21-13-11-12-16-24(21)28(25)22-14-9-8-10-15-22;/h8-20,28,33H,1-7H3;/q;+1/p-1/b30-25-;/t28-;/m1./s1 |
| InChIKey | RYQFWOOYUNTGJV-OLPCRNLPSA-M |
| XLogP | 4.10 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|