C16H14N2O — CID 134873908
N'-methyl-3-oxo-N,2-diphenylprop-2-enimidamide (PubChem CID 134873908) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is N'-methyl-3-oxo-N,2-diphenylprop-2-enimidamide.
| Compound Name | N'-methyl-3-oxo-N,2-diphenylprop-2-enimidamide |
|---|---|
| PubChem CID | 134873908 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N'-methyl-3-oxo-N,2-diphenylprop-2-enimidamide |
| SMILES | C/N=C(/Nc1ccccc1)C(=C=O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O/c1-17-16(18-14-10-6-3-7-11-14)15(12-19)13-8-4-2-5-9-13/h2-11H,1H3,(H,17,18) |
| InChIKey | YIHZFBXZZYYASW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|