C12H13NS — CID 101106333
methyl N-methyl-2-phenylbuta-2,3-dienimidothioate (PubChem CID 101106333) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is methyl N-methyl-2-phenylbuta-2,3-dienimidothioate.
| Compound Name | methyl N-methyl-2-phenylbuta-2,3-dienimidothioate |
|---|---|
| PubChem CID | 101106333 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | methyl N-methyl-2-phenylbuta-2,3-dienimidothioate |
| SMILES | C=C=C(/C(=N/C)SC)c1ccccc1 |
| InChI | InChI=1S/C12H13NS/c1-4-11(12(13-2)14-3)10-8-6-5-7-9-10/h5-9H,1H2,2-3H3/b13-12- |
| InChIKey | UJKWPLQDMOYTHQ-SEYXRHQNSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|