C21H26O6Se — CID 134874698
(2S,3S,4S,5R)-2-(2-hydroxyethoxy)-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-ol (PubChem CID 134874698) has the molecular formula C21H26O6Se and a molecular weight of 453.39 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-(2-hydroxyethoxy)-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-ol.
| Compound Name | (2S,3S,4S,5R)-2-(2-hydroxyethoxy)-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-ol |
|---|---|
| PubChem CID | 134874698 |
| Molecular Formula | C21H26O6Se |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (2S,3S,4S,5R)-2-(2-hydroxyethoxy)-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-ol |
| SMILES | COc1ccc(COC2CO[C@H](OCCO)[C@@H]([Se]c3ccccc3)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H26O6Se/c1-24-16-9-7-15(8-10-16)13-26-18-14-27-21(25-12-11-22)20(19(18)23)28-17-5-3-2-4-6-17/h2-10,18-23H,11-14H2,1H3/t18?,19-,20-,21-/m0/s1 |
| InChIKey | HCWNZRJKLAXXPH-KTYMLHDXSA-N |
| XLogP | 1.12 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|