C39H78O6Si3 — CID 134875791
2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(1S,2S)-2-[(Z)-2-methoxyethenyl]-1-methylcyclopropyl]-4,4,6,8-tetramethyl-5-oxoundecanoate (PubChem CID 134875791) has the molecular formula C39H78O6Si3 and a molecular weight of 727.30 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(1S,2S)-2-[(Z)-2-methoxyethenyl]-1-methylcyclopropyl]-4,4,6,8-tetramethyl-5-oxoundecanoate.
| Compound Name | 2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(1S,2S)-2-[(Z)-2-methoxyethenyl]-1-methylcyclopropyl]-4,4,6,8-tetramethyl-5-oxoundecanoate |
|---|---|
| PubChem CID | 134875791 |
| Molecular Formula | C39H78O6Si3 |
| Molecular Weight | 727.30 g/mol |
| Exact Mass | 726.51 |
| IUPAC Name | 2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[(1S,2S)-2-[(Z)-2-methoxyethenyl]-1-methylcyclopropyl]-4,4,6,8-tetramethyl-5-oxoundecanoate |
| SMILES | CO/C=C\[C@@H]1C[C@]1(C)CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)OCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H78O6Si3/c1-29(21-20-23-39(11)28-31(39)22-24-42-12)34(45-48(18,19)37(6,7)8)30(2)35(41)38(9,10)32(44-47(16,17)36(3,4)5)27-33(40)43-25-26-46(13,14)15/h22,24,29-32,34H,20-21,23,25-28H2,1-19H3/b24-22-/t29-,30+,31+,32-,34-,39-/m0/s1 |
| InChIKey | GNFJSPQKBXEWGW-ZFXKQBLJSA-N |
| XLogP | 11.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.30 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|