C20H24NOSe+ — CID 134883559
(3S,4S)-2-pentan-3-ylidene-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium (PubChem CID 134883559) has the molecular formula C20H24NOSe+ and a molecular weight of 373.38 g/mol. Its IUPAC name is (3S,4S)-2-pentan-3-ylidene-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium.
| Compound Name | (3S,4S)-2-pentan-3-ylidene-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium |
|---|---|
| PubChem CID | 134883559 |
| Molecular Formula | C20H24NOSe+ |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (3S,4S)-2-pentan-3-ylidene-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium |
| SMILES | CCC(CC)=[N+]1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H24NOSe/c1-3-17(4-2)21-20(16-11-7-5-8-12-16)19(15-22-21)23-18-13-9-6-10-14-18/h5-14,19-20H,3-4,15H2,1-2H3/q+1/t19-,20+/m1/s1 |
| InChIKey | VFCGHFBJZYDCLL-UXHICEINSA-N |
| XLogP | 3.76 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|