C20H26ClOSe — CID 134884167
CID 134884167 (PubChem CID 134884167) has the molecular formula C20H26ClOSe and a molecular weight of 396.84 g/mol.
| Compound Name | CID 134884167 |
|---|---|
| PubChem CID | 134884167 |
| Molecular Formula | C20H26ClOSe |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | — |
| SMILES | [CH][Se]1(Cl)(C/C=C/c2ccccc2)CC23CCC(CC2O1)C3(C)C |
| InChI | InChI=1S/C20H26ClOSe/c1-19(2)17-11-12-20(19)15-23(3,21,22-18(20)14-17)13-7-10-16-8-5-4-6-9-16/h3-10,17-18H,11-15H2,1-2H3/b10-7+ |
| InChIKey | NGAJUIXEHGEEDS-JXMROGBWSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|